C13H22N2 — CID 93225665
4-N,4-N-dimethyl-1-N-[(2S)-2-methylbutyl]benzene-1,4-diamine (PubChem CID 93225665) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[(2S)-2-methylbutyl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-[(2S)-2-methylbutyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 93225665 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[(2S)-2-methylbutyl]benzene-1,4-diamine |
| SMILES | CC[C@H](C)CNc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H22N2/c1-5-11(2)10-14-12-6-8-13(9-7-12)15(3)4/h6-9,11,14H,5,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | HFUKDWNBEZITFF-NSHDSACASA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|