C15H24O4S — CID 54757364
ethyl (1S,3aR,7aS)-1-ethylsulfanylcarbonyl-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate (PubChem CID 54757364) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is ethyl (1S,3aR,7aS)-1-ethylsulfanylcarbonyl-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | ethyl (1S,3aR,7aS)-1-ethylsulfanylcarbonyl-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 54757364 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl (1S,3aR,7aS)-1-ethylsulfanylcarbonyl-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCC[C@]1(O)[C@@H](C(=O)SCC)CC2 |
| InChI | InChI=1S/C15H24O4S/c1-3-19-13(17)14-8-5-6-9-15(14,18)11(7-10-14)12(16)20-4-2/h11,18H,3-10H2,1-2H3/t11-,14+,15+/m1/s1 |
| InChIKey | PQXNEWKQWKHHHF-UGFHNGPFSA-N |
| XLogP | 2.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|