C14H21ClO4 — CID 134861012
ethyl (3aS,6S,7R,7aR)-7-acetyl-6-chloro-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate (PubChem CID 134861012) has the molecular formula C14H21ClO4 and a molecular weight of 288.77 g/mol. Its IUPAC name is ethyl (3aS,6S,7R,7aR)-7-acetyl-6-chloro-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | ethyl (3aS,6S,7R,7aR)-7-acetyl-6-chloro-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 134861012 |
| Molecular Formula | C14H21ClO4 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | ethyl (3aS,6S,7R,7aR)-7-acetyl-6-chloro-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC[C@@]1(O)[C@H](C(C)=O)[C@@H](Cl)CC2 |
| InChI | InChI=1S/C14H21ClO4/c1-3-19-12(17)13-6-4-7-14(13,18)11(9(2)16)10(15)5-8-13/h10-11,18H,3-8H2,1-2H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | OTUKFBYSYROCTK-OIMNJJJWSA-N |
| XLogP | 2.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|