C18H20CuN3O2 — CID 5475945
bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]azanide;copper(1+) (PubChem CID 5475945) has the molecular formula C18H20CuN3O2 and a molecular weight of 373.92 g/mol. Its IUPAC name is bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]azanide;copper(1+).
| Compound Name | bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]azanide;copper(1+) |
|---|---|
| PubChem CID | 5475945 |
| Molecular Formula | C18H20CuN3O2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | bis[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]azanide;copper(1+) |
| SMILES | O=C1C=CC=C/C1=C/NCC[N-]CCN/C=C1/C=CC=CC1=O.[Cu+] |
| InChI | InChI=1S/C18H20N3O2.Cu/c22-17-7-3-1-5-15(17)13-20-11-9-19-10-12-21-14-16-6-2-4-8-18(16)23;/h1-8,13-14,20-21H,9-12H2;/q-1;+1/b15-13-,16-14-; |
| InChIKey | ULRGCUSWGDRXJK-MWEBDPMNSA-N |
| XLogP | 1.69 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|