C12H14FNO4 — CID 54759479
6-cyclohexyl-3-fluoro-1-hydroxy-2-oxopyridine-4-carboxylic acid (PubChem CID 54759479) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is 6-cyclohexyl-3-fluoro-1-hydroxy-2-oxopyridine-4-carboxylic acid.
| Compound Name | 6-cyclohexyl-3-fluoro-1-hydroxy-2-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 54759479 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 6-cyclohexyl-3-fluoro-1-hydroxy-2-oxopyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CCCCC2)n(O)c(=O)c1F |
| InChI | InChI=1S/C12H14FNO4/c13-10-8(12(16)17)6-9(14(18)11(10)15)7-4-2-1-3-5-7/h6-7,18H,1-5H2,(H,16,17) |
| InChIKey | CBNHRVAXPFWUPT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|