C12H13F2NO4 — CID 54759483
2-cyclohexyl-3,5-difluoro-1-hydroxy-6-oxopyridine-4-carboxylic acid (PubChem CID 54759483) has the molecular formula C12H13F2NO4 and a molecular weight of 273.23 g/mol. Its IUPAC name is 2-cyclohexyl-3,5-difluoro-1-hydroxy-6-oxopyridine-4-carboxylic acid.
| Compound Name | 2-cyclohexyl-3,5-difluoro-1-hydroxy-6-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 54759483 |
| Molecular Formula | C12H13F2NO4 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-cyclohexyl-3,5-difluoro-1-hydroxy-6-oxopyridine-4-carboxylic acid |
| SMILES | O=C(O)c1c(F)c(C2CCCCC2)n(O)c(=O)c1F |
| InChI | InChI=1S/C12H13F2NO4/c13-8-7(12(17)18)9(14)11(16)15(19)10(8)6-4-2-1-3-5-6/h6,19H,1-5H2,(H,17,18) |
| InChIKey | UQVYTKXSKWNIJJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|