C12H15F2NO3 — CID 54759291
6-cyclohexyl-3,5-difluoro-1-hydroxy-4-(hydroxymethyl)pyridin-2-one (PubChem CID 54759291) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 6-cyclohexyl-3,5-difluoro-1-hydroxy-4-(hydroxymethyl)pyridin-2-one.
| Compound Name | 6-cyclohexyl-3,5-difluoro-1-hydroxy-4-(hydroxymethyl)pyridin-2-one |
|---|---|
| PubChem CID | 54759291 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 6-cyclohexyl-3,5-difluoro-1-hydroxy-4-(hydroxymethyl)pyridin-2-one |
| SMILES | O=c1c(F)c(CO)c(F)c(C2CCCCC2)n1O |
| InChI | InChI=1S/C12H15F2NO3/c13-9-8(6-16)10(14)12(17)15(18)11(9)7-4-2-1-3-5-7/h7,16,18H,1-6H2 |
| InChIKey | WIXAGAIVUYNKFU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|