C12H15F2NO2 — CID 54759484
6-(1-deuteriocyclohexyl)-3,5-difluoro-1-hydroxy-4-methylpyridin-2-one (PubChem CID 54759484) has the molecular formula C12H15F2NO2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 6-(1-deuteriocyclohexyl)-3,5-difluoro-1-hydroxy-4-methylpyridin-2-one.
| Compound Name | 6-(1-deuteriocyclohexyl)-3,5-difluoro-1-hydroxy-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 54759484 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 6-(1-deuteriocyclohexyl)-3,5-difluoro-1-hydroxy-4-methylpyridin-2-one |
| SMILES | [2H]C1(c2c(F)c(C)c(F)c(=O)n2O)CCCCC1 |
| InChI | InChI=1S/C12H15F2NO2/c1-7-9(13)11(8-5-3-2-4-6-8)15(17)12(16)10(7)14/h8,17H,2-6H2,1H3/i8D |
| InChIKey | ZISPFOYZQOUIFS-BNEYPBHNSA-N |
| XLogP | 2.72 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|