C12H14F3NO2 — CID 54761670
6-cyclohexyl-3,5-difluoro-4-(fluoromethyl)-1-hydroxypyridin-2-one (PubChem CID 54761670) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 6-cyclohexyl-3,5-difluoro-4-(fluoromethyl)-1-hydroxypyridin-2-one.
| Compound Name | 6-cyclohexyl-3,5-difluoro-4-(fluoromethyl)-1-hydroxypyridin-2-one |
|---|---|
| PubChem CID | 54761670 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-cyclohexyl-3,5-difluoro-4-(fluoromethyl)-1-hydroxypyridin-2-one |
| SMILES | O=c1c(F)c(CF)c(F)c(C2CCCCC2)n1O |
| InChI | InChI=1S/C12H14F3NO2/c13-6-8-9(14)11(7-4-2-1-3-5-7)16(18)12(17)10(8)15/h7,18H,1-6H2 |
| InChIKey | ZCNRPZLDQAKNCS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|