C12H15NO4 — CID 54759856
3,5-dideuterio-2-(1-deuteriocyclohexyl)-1-hydroxy-6-oxopyridine-4-carboxylic acid (PubChem CID 54759856) has the molecular formula C12H15NO4 and a molecular weight of 240.27 g/mol. Its IUPAC name is 3,5-dideuterio-2-(1-deuteriocyclohexyl)-1-hydroxy-6-oxopyridine-4-carboxylic acid.
| Compound Name | 3,5-dideuterio-2-(1-deuteriocyclohexyl)-1-hydroxy-6-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 54759856 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3,5-dideuterio-2-(1-deuteriocyclohexyl)-1-hydroxy-6-oxopyridine-4-carboxylic acid |
| SMILES | [2H]c1c(C(=O)O)c([2H])c(=O)n(O)c1C1([2H])CCCCC1 |
| InChI | InChI=1S/C12H15NO4/c14-11-7-9(12(15)16)6-10(13(11)17)8-4-2-1-3-5-8/h6-8,17H,1-5H2,(H,15,16)/i6D,7D,8D |
| InChIKey | BJSPXVZYYUHXQD-AYBVGXBASA-N |
| XLogP | 1.83 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|