C21H25N5O4 — CID 54759977
2-(diethylamino)-N-[2,4-dimethyl-5-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]acetamide (PubChem CID 54759977) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(diethylamino)-N-[2,4-dimethyl-5-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]acetamide.
| Compound Name | 2-(diethylamino)-N-[2,4-dimethyl-5-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 54759977 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-(diethylamino)-N-[2,4-dimethyl-5-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]acetamide |
| SMILES | CCN(CC)CC(=O)Nc1c(C)[nH]c(/C=C2\C(=O)Nc3ccc([N+](=O)[O-])cc32)c1C |
| InChI | InChI=1S/C21H25N5O4/c1-5-25(6-2)11-19(27)24-20-12(3)18(22-13(20)4)10-16-15-9-14(26(29)30)7-8-17(15)23-21(16)28/h7-10,22H,5-6,11H2,1-4H3,(H,23,28)(H,24,27)/b16-10- |
| InChIKey | ADHXKEHDWQDVDX-YBEGLDIGSA-N |
| XLogP | 3.31 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|