C16H17F3O — CID 54760272
(4aR,9aS)-5,6,7-trifluoro-1,1,4a-trimethyl-2,3,4,9a-tetrahydrofluoren-9-one (PubChem CID 54760272) has the molecular formula C16H17F3O and a molecular weight of 282.30 g/mol. Its IUPAC name is (4aR,9aS)-5,6,7-trifluoro-1,1,4a-trimethyl-2,3,4,9a-tetrahydrofluoren-9-one.
| Compound Name | (4aR,9aS)-5,6,7-trifluoro-1,1,4a-trimethyl-2,3,4,9a-tetrahydrofluoren-9-one |
|---|---|
| PubChem CID | 54760272 |
| Molecular Formula | C16H17F3O |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (4aR,9aS)-5,6,7-trifluoro-1,1,4a-trimethyl-2,3,4,9a-tetrahydrofluoren-9-one |
| SMILES | CC1(C)CCC[C@@]2(C)c3c(cc(F)c(F)c3F)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H17F3O/c1-15(2)5-4-6-16(3)10-8(13(20)14(15)16)7-9(17)11(18)12(10)19/h7,14H,4-6H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | MAEBFFFPVOSYRK-HOCLYGCPSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|