C21H22F3NO5 — CID 54762647
dimethyl 5-cyclohexylimino-2-phenyl-2-(trifluoromethyl)furan-3,4-dicarboxylate (PubChem CID 54762647) has the molecular formula C21H22F3NO5 and a molecular weight of 425.40 g/mol. Its IUPAC name is dimethyl 5-cyclohexylimino-2-phenyl-2-(trifluoromethyl)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 5-cyclohexylimino-2-phenyl-2-(trifluoromethyl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 54762647 |
| Molecular Formula | C21H22F3NO5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | dimethyl 5-cyclohexylimino-2-phenyl-2-(trifluoromethyl)furan-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)(C(F)(F)F)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C21H22F3NO5/c1-28-18(26)15-16(19(27)29-2)20(21(22,23)24,13-9-5-3-6-10-13)30-17(15)25-14-11-7-4-8-12-14/h3,5-6,9-10,14H,4,7-8,11-12H2,1-2H3/b25-17- |
| InChIKey | BQNYGCWPRIIBNT-UQQQWYQISA-N |
| XLogP | 3.85 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|