C23H23NO6 — CID 15437614
dimethyl 5-cyclohexylimino-4'-oxospiro[furan-2,1'-naphthalene]-3,4-dicarboxylate (PubChem CID 15437614) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is dimethyl 5-cyclohexylimino-4'-oxospiro[furan-2,1'-naphthalene]-3,4-dicarboxylate.
| Compound Name | dimethyl 5-cyclohexylimino-4'-oxospiro[furan-2,1'-naphthalene]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15437614 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | dimethyl 5-cyclohexylimino-4'-oxospiro[furan-2,1'-naphthalene]-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C=CC(=O)c3ccccc32)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C23H23NO6/c1-28-21(26)18-19(22(27)29-2)23(30-20(18)24-14-8-4-3-5-9-14)13-12-17(25)15-10-6-7-11-16(15)23/h6-7,10-14H,3-5,8-9H2,1-2H3/b24-20- |
| InChIKey | WAVPJUJIAGIOIY-GFMRDNFCSA-N |
| XLogP | 3.04 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|