C25H23NO6 — CID 11407850
dimethyl 5'-cyclohexylimino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate (PubChem CID 11407850) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is dimethyl 5'-cyclohexylimino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate.
| Compound Name | dimethyl 5'-cyclohexylimino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11407850 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | dimethyl 5'-cyclohexylimino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(O/C1=N\C1CCCCC1)C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C25H23NO6/c1-30-23(28)19-20(24(29)31-2)25(32-22(19)26-15-10-4-3-5-11-15)17-13-7-9-14-8-6-12-16(18(14)17)21(25)27/h6-9,12-13,15H,3-5,10-11H2,1-2H3/b26-22- |
| InChIKey | KUZNOHNJFCJCBT-ROMGYVFFSA-N |
| XLogP | 3.64 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|