C29H25NO6 — CID 11583887
diethyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate (PubChem CID 11583887) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is diethyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate.
| Compound Name | diethyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11583887 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | diethyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(O/C1=N\c1c(C)cccc1C)C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C29H25NO6/c1-5-34-27(32)22-23(28(33)35-6-2)29(36-26(22)30-24-16(3)10-7-11-17(24)4)20-15-9-13-18-12-8-14-19(21(18)20)25(29)31/h7-15H,5-6H2,1-4H3/b30-26- |
| InChIKey | INOUADGUACOWRQ-BXVZCJGGSA-N |
| XLogP | 5.03 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|