C27H27NO6 — CID 101272693
dimethyl 2-benzoyl-5-cyclohexylimino-2-phenylfuran-3,4-dicarboxylate (PubChem CID 101272693) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is dimethyl 2-benzoyl-5-cyclohexylimino-2-phenylfuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2-benzoyl-5-cyclohexylimino-2-phenylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101272693 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | dimethyl 2-benzoyl-5-cyclohexylimino-2-phenylfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)c2ccccc2)(c2ccccc2)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C27H27NO6/c1-32-25(30)21-22(26(31)33-2)27(19-14-8-4-9-15-19,23(29)18-12-6-3-7-13-18)34-24(21)28-20-16-10-5-11-17-20/h3-4,6-9,12-15,20H,5,10-11,16-17H2,1-2H3/b28-24- |
| InChIKey | TZNBHFZYKVWORN-COOPMVRXSA-N |
| XLogP | 4.17 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|