C21H22N6O4 — CID 54766422
1-[3-[(E)-3-morpholin-4-ylprop-1-enyl]-1H-indazol-6-yl]-3-(4-nitrophenyl)urea (PubChem CID 54766422) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is 1-[3-[(E)-3-morpholin-4-ylprop-1-enyl]-1H-indazol-6-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[3-[(E)-3-morpholin-4-ylprop-1-enyl]-1H-indazol-6-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 54766422 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[3-[(E)-3-morpholin-4-ylprop-1-enyl]-1H-indazol-6-yl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1ccc2c(/C=C/CN3CCOCC3)n[nH]c2c1 |
| InChI | InChI=1S/C21H22N6O4/c28-21(22-15-3-6-17(7-4-15)27(29)30)23-16-5-8-18-19(24-25-20(18)14-16)2-1-9-26-10-12-31-13-11-26/h1-8,14H,9-13H2,(H,24,25)(H2,22,23,28)/b2-1+ |
| InChIKey | RGQUJULSNFIVLF-OWOJBTEDSA-N |
| XLogP | 3.46 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|