About 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine
3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine (PubChem CID 54767408) has the molecular formula C15H23ClN2O
and a molecular weight of 282.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine |
| PubChem CID | 54767408 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine |
| SMILES | CN(C)CCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C15H23ClN2O/c1-17(2)8-7-15(18-9-11-19-12-10-18)13-3-5-14(16)6-4-13/h3-6,15H,7-12H2,1-2H3 |
| InChIKey | ZGHQVNYQNYKDCM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine?
The IUPAC name of 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine (CID 54767408) is 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine.
What is the SMILES notation for 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine?
The canonical SMILES for 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine is CN(C)CCC(c1ccc(Cl)cc1)N1CCOCC1.
What is the InChIKey of 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine?
The InChIKey is ZGHQVNYQNYKDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2O/c1-17(2)8-7-15(18-9-11-19-12-10-18)13-3-5-14(16)6-4-13/h3-6,15H,7-12H2,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine?
3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine has a molecular weight of 282.81 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-N,N-dimethyl-3-morpholin-4-ylpropan-1-amine is sourced from PubChem (CID 54767408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).