C29H47NO6 — CID 54768333
tert-butyl (1S)-1-(3-decanoyloxypropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 54768333) has the molecular formula C29H47NO6 and a molecular weight of 505.70 g/mol. Its IUPAC name is tert-butyl (1S)-1-(3-decanoyloxypropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1S)-1-(3-decanoyloxypropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 54768333 |
| Molecular Formula | C29H47NO6 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | tert-butyl (1S)-1-(3-decanoyloxypropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCCCCCCCCC(=O)OCCC[C@H]1c2cc(OC)c(OC)cc2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H47NO6/c1-7-8-9-10-11-12-13-16-27(31)35-19-14-15-24-23-21-26(34-6)25(33-5)20-22(23)17-18-30(24)28(32)36-29(2,3)4/h20-21,24H,7-19H2,1-6H3/t24-/m0/s1 |
| InChIKey | MISDDIHICYTTQL-DEOSSOPVSA-N |
| XLogP | 7.00 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|