C27H37NO5 — CID 71660199
5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl 3-(4-methoxyphenyl)propanoate (PubChem CID 71660199) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is 5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl 3-(4-methoxyphenyl)propanoate.
| Compound Name | 5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 71660199 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OCCCCCC2c3cc(OC)c(OC)cc3CCN2C)cc1 |
| InChI | InChI=1S/C27H37NO5/c1-28-16-15-21-18-25(31-3)26(32-4)19-23(21)24(28)8-6-5-7-17-33-27(29)14-11-20-9-12-22(30-2)13-10-20/h9-10,12-13,18-19,24H,5-8,11,14-17H2,1-4H3 |
| InChIKey | UJDNJXHSYJLIQE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|