C44H62N2O9 — CID 10771431
9-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]nonyl 3-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propanoate (PubChem CID 10771431) has the molecular formula C44H62N2O9 and a molecular weight of 762.98 g/mol. Its IUPAC name is 9-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]nonyl 3-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propanoate.
| Compound Name | 9-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]nonyl 3-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 10771431 |
| Molecular Formula | C44H62N2O9 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.45 |
| IUPAC Name | 9-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]nonyl 3-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propanoate |
| SMILES | COc1ccc(C[C@@H]2c3cc(OC)c(OC)cc3CCN2CCCCCCCCCOC(=O)CCN2CCc3c(cc(OC)c(OC)c3OC)C2)cc1OC |
| InChI | InChI=1S/C44H62N2O9/c1-48-37-16-15-31(26-38(37)49-2)25-36-35-29-40(51-4)39(50-3)27-32(35)17-23-46(36)20-13-11-9-8-10-12-14-24-55-42(47)19-22-45-21-18-34-33(30-45)28-41(52-5)44(54-7)43(34)53-6/h15-16,26-29,36H,8-14,17-25,30H2,1-7H3/t36-/m1/s1 |
| InChIKey | ZLYSJYQQKVCGJQ-PSXMRANNSA-N |
| XLogP | 7.61 |
| TPSA | 97.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|