C25H32N2O9 — CID 160889405
1,2-dihydroperoxyethyne;3-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide (PubChem CID 160889405) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is 1,2-dihydroperoxyethyne;3-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide.
| Compound Name | 1,2-dihydroperoxyethyne;3-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide |
|---|---|
| PubChem CID | 160889405 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1,2-dihydroperoxyethyne;3-[(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide |
| SMILES | COc1ccc(C[C@@H]2c3cc(OC)c(OC)cc3CCN2CCC(N)=O)cc1OC.OOC#COO |
| InChI | InChI=1S/C23H30N2O5.C2H2O4/c1-27-19-6-5-15(12-20(19)28-2)11-18-17-14-22(30-4)21(29-3)13-16(17)7-9-25(18)10-8-23(24)26;3-5-1-2-6-4/h5-6,12-14,18H,7-11H2,1-4H3,(H2,24,26);3-4H/t18-;/m1./s1 |
| InChIKey | SOBJUBVTBZQUAF-GMUIIQOCSA-N |
| XLogP | 2.62 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|