C25H32N2O9 — CID 68782866
2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide;oxalic acid (PubChem CID 68782866) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide;oxalic acid.
| Compound Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide;oxalic acid |
|---|---|
| PubChem CID | 68782866 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanamide;oxalic acid |
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3CCN2C(C)C(N)=O)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30N2O5.C2H2O4/c1-14(23(24)26)25-9-8-16-12-21(29-4)22(30-5)13-17(16)18(25)10-15-6-7-19(27-2)20(11-15)28-3;3-1(4)2(5)6/h6-7,11-14,18H,8-10H2,1-5H3,(H2,24,26);(H,3,4)(H,5,6) |
| InChIKey | HEFZFSOBLSJJDI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|