C28H29NO6 — CID 58689879
2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]-2-phenylacetic acid (PubChem CID 58689879) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]-2-phenylacetic acid.
| Compound Name | 2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 58689879 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]-2-phenylacetic acid |
| SMILES | COc1ccc(CC2c3cc4c(cc3CCN2C(C(=O)O)c2ccccc2)OCCO4)cc1OC |
| InChI | InChI=1S/C28H29NO6/c1-32-23-9-8-18(15-24(23)33-2)14-22-21-17-26-25(34-12-13-35-26)16-20(21)10-11-29(22)27(28(30)31)19-6-4-3-5-7-19/h3-9,15-17,22,27H,10-14H2,1-2H3,(H,30,31) |
| InChIKey | CZTVAJRSBRTIBJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |