C32H37N3O5 — CID 10302516
N-(2-cyanoethyl)-2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-phenylacetamide (PubChem CID 10302516) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10302516 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | N-(2-cyanoethyl)-2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-phenylacetamide |
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3CCCN2C(C(=O)NCCC#N)c2ccccc2)cc1OC |
| InChI | InChI=1S/C32H37N3O5/c1-37-27-14-13-22(19-28(27)38-2)18-26-25-21-30(40-4)29(39-3)20-24(25)12-8-17-35(26)31(23-10-6-5-7-11-23)32(36)34-16-9-15-33/h5-7,10-11,13-14,19-21,26,31H,8-9,12,16-18H2,1-4H3,(H,34,36) |
| InChIKey | KAPJZIZYQXSZOG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|