C25H34N2O5 — CID 71660229
5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl N-(4-methoxyphenyl)carbamate (PubChem CID 71660229) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl N-(4-methoxyphenyl)carbamate.
| Compound Name | 5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 71660229 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 5-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)pentyl N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OCCCCCC2c3cc(OC)c(OC)cc3CCN2C)cc1 |
| InChI | InChI=1S/C25H34N2O5/c1-27-14-13-18-16-23(30-3)24(31-4)17-21(18)22(27)8-6-5-7-15-32-25(28)26-19-9-11-20(29-2)12-10-19/h9-12,16-17,22H,5-8,13-15H2,1-4H3,(H,26,28) |
| InChIKey | JCNCTIOJXWEAIO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|