C39H44O7 — CID 54768549
methyl 2-methyl-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate (PubChem CID 54768549) has the molecular formula C39H44O7 and a molecular weight of 624.77 g/mol. Its IUPAC name is methyl 2-methyl-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl 2-methyl-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 54768549 |
| Molecular Formula | C39H44O7 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | methyl 2-methyl-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)C(C)C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H44O7/c1-29(39(40)41-2)23-34-36(43-25-31-17-9-4-10-18-31)38(45-27-33-21-13-6-14-22-33)37(44-26-32-19-11-5-12-20-32)35(46-34)28-42-24-30-15-7-3-8-16-30/h3-22,29,34-38H,23-28H2,1-2H3/t29?,34-,35-,36+,37-,38-/m1/s1 |
| InChIKey | LMAKSTDMUHWIAQ-KBNKKPLFSA-N |
| XLogP | 6.93 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |