About [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea
[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea (PubChem CID 54768954) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea.
Molecular Properties
| Compound Name | [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea |
| PubChem CID | 54768954 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3S/c17-16(20)19-18-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H,(H3,17,19,20)/b12-11+,18-15- |
| InChIKey | ZYBFBSIRRZYCDS-YIKZKUGMSA-N |
| XLogP | 2.94 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea?
The IUPAC name of [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea (CID 54768954) is [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea.
What is the SMILES notation for [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea?
The canonical SMILES for [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea is NC(=S)N/N=C(/C=C/c1ccccc1)c1ccccc1.
What is the InChIKey of [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea?
The InChIKey is ZYBFBSIRRZYCDS-YIKZKUGMSA-N. The full InChI is InChI=1S/C16H15N3S/c17-16(20)19-18-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H,(H3,17,19,20)/b12-11+,18-15-.
What are the key properties of [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea?
[(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea has a molecular weight of 281.38 g/mol, XLogP of 2.94, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[(E)-1,3-diphenylprop-2-enylidene]amino]thiourea is sourced from PubChem (CID 54768954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).