C24H33BrO2 — CID 54770025
(8R,9S,13S,14S,17R)-17-[[2-(2-bromoethyl)cyclopropyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 54770025) has the molecular formula C24H33BrO2 and a molecular weight of 433.43 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-17-[[2-(2-bromoethyl)cyclopropyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-17-[[2-(2-bromoethyl)cyclopropyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 54770025 |
| Molecular Formula | C24H33BrO2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-[[2-(2-bromoethyl)cyclopropyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)CC1CC1CCBr |
| InChI | InChI=1S/C24H33BrO2/c1-23-9-6-20-19-5-3-18(26)13-16(19)2-4-21(20)22(23)7-10-24(23,27)14-17-12-15(17)8-11-25/h3,5,13,15,17,20-22,26-27H,2,4,6-12,14H2,1H3/t15?,17?,20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | TXPHTLGCQOXNCE-CWIZEDJBSA-N |
| XLogP | 5.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|