C24H29NO2 — CID 58650868
(13S,17R)-13-methyl-17-(pyridin-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 58650868) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (13S,17R)-13-methyl-17-(pyridin-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,17R)-13-methyl-17-(pyridin-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 58650868 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (13S,17R)-13-methyl-17-(pyridin-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@@]2(O)Cc1ccccn1 |
| InChI | InChI=1S/C24H29NO2/c1-23-11-9-20-19-8-6-18(26)14-16(19)5-7-21(20)22(23)10-12-24(23,27)15-17-4-2-3-13-25-17/h2-4,6,8,13-14,20-22,26-27H,5,7,9-12,15H2,1H3/t20?,21?,22?,23-,24+/m0/s1 |
| InChIKey | TZBNFXLBFVBFMS-QGOPKKHISA-N |
| XLogP | 4.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |