C14H13NO4 — CID 54772530
3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-phenylpropanoic acid (PubChem CID 54772530) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-phenylpropanoic acid.
| Compound Name | 3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 54772530 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-phenylpropanoic acid |
| SMILES | O=C(O)C(CN1C(=O)C2CC2C1=O)c1ccccc1 |
| InChI | InChI=1S/C14H13NO4/c16-12-9-6-10(9)13(17)15(12)7-11(14(18)19)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2,(H,18,19) |
| InChIKey | SVDBSEYPMGVSQE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|