C24H20N4O7 — CID 54775167
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,3-bis(4-nitrophenyl)propanamide (PubChem CID 54775167) has the molecular formula C24H20N4O7 and a molecular weight of 476.45 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,3-bis(4-nitrophenyl)propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,3-bis(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 54775167 |
| Molecular Formula | C24H20N4O7 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,3-bis(4-nitrophenyl)propanamide |
| SMILES | O=C(CC(c1ccc([N+](=O)[O-])cc1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20N4O7/c29-20(25-16-5-9-18(10-6-16)28(34)35)12-19(13-3-7-17(8-4-13)27(32)33)26-23(30)21-14-1-2-15(11-14)22(21)24(26)31/h1-10,14-15,19,21-22H,11-12H2,(H,25,29) |
| InChIKey | DTNDHVOLWOHKAJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|