C22H19N3O7 — CID 54775017
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-hydroxyphenyl)-3-(5-nitrofuran-2-yl)propanamide (PubChem CID 54775017) has the molecular formula C22H19N3O7 and a molecular weight of 437.41 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-hydroxyphenyl)-3-(5-nitrofuran-2-yl)propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-hydroxyphenyl)-3-(5-nitrofuran-2-yl)propanamide |
|---|---|
| PubChem CID | 54775017 |
| Molecular Formula | C22H19N3O7 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-hydroxyphenyl)-3-(5-nitrofuran-2-yl)propanamide |
| SMILES | O=C(CC(c1ccc([N+](=O)[O-])o1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H19N3O7/c26-14-5-3-13(4-6-14)23-17(27)10-15(16-7-8-18(32-16)25(30)31)24-21(28)19-11-1-2-12(9-11)20(19)22(24)29/h1-8,11-12,15,19-20,26H,9-10H2,(H,23,27) |
| InChIKey | MCRGSSLYKFHLHG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|