C22H17Cl2N3O6 — CID 54775026
N-(2,4-dichlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)propanamide (PubChem CID 54775026) has the molecular formula C22H17Cl2N3O6 and a molecular weight of 490.30 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)propanamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)propanamide |
|---|---|
| PubChem CID | 54775026 |
| Molecular Formula | C22H17Cl2N3O6 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)propanamide |
| SMILES | O=C(CC(c1ccc([N+](=O)[O-])o1)N1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl2N3O6/c23-12-3-4-14(13(24)8-12)25-17(28)9-15(16-5-6-18(33-16)27(31)32)26-21(29)19-10-1-2-11(7-10)20(19)22(26)30/h1-6,8,10-11,15,19-20H,7,9H2,(H,25,28) |
| InChIKey | NIQZGLKXNXEKPL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|