C21H21N5O6S — CID 54775286
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 54775286) has the molecular formula C21H21N5O6S and a molecular weight of 471.50 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 54775286 |
| Molecular Formula | C21H21N5O6S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(5-nitrofuran-2-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCc1nnc(NC(=O)CC(c2ccc([N+](=O)[O-])o2)N2C(=O)C3C4C=CC(C4)C3C2=O)s1 |
| InChI | InChI=1S/C21H21N5O6S/c1-2-3-15-23-24-21(33-15)22-14(27)9-12(13-6-7-16(32-13)26(30)31)25-19(28)17-10-4-5-11(8-10)18(17)20(25)29/h4-7,10-12,17-18H,2-3,8-9H2,1H3,(H,22,24,27) |
| InChIKey | RENXGFGGRIZFFN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|