C28H32N2O3 — CID 54779922
3-butan-2-yl-2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 54779922) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 3-butan-2-yl-2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-butan-2-yl-2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 54779922 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 3-butan-2-yl-2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | CCC(C)N1C(=O)c2ccccc2NC1c1ccc(OCCCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C28H32N2O3/c1-4-20(2)30-27(29-24-15-9-8-14-23(24)28(30)31)22-16-17-25(26(19-22)32-3)33-18-10-13-21-11-6-5-7-12-21/h5-9,11-12,14-17,19-20,27,29H,4,10,13,18H2,1-3H3 |
| InChIKey | HEHMBELOSZNKGD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|