C14H21ClN2O5S — CID 5478301
1-[(E)-3-chloroprop-2-enyl]-4-(2-methoxyphenyl)piperazine;sulfuric acid (PubChem CID 5478301) has the molecular formula C14H21ClN2O5S and a molecular weight of 364.85 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-4-(2-methoxyphenyl)piperazine;sulfuric acid.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-4-(2-methoxyphenyl)piperazine;sulfuric acid |
|---|---|
| PubChem CID | 5478301 |
| Molecular Formula | C14H21ClN2O5S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-4-(2-methoxyphenyl)piperazine;sulfuric acid |
| SMILES | COc1ccccc1N1CCN(C/C=C/Cl)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C14H19ClN2O.H2O4S/c1-18-14-6-3-2-5-13(14)17-11-9-16(10-12-17)8-4-7-15;1-5(2,3)4/h2-7H,8-12H2,1H3;(H2,1,2,3,4)/b7-4+; |
| InChIKey | XUIXBYFENGGXAU-KQGICBIGSA-N |
| XLogP | 1.92 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|