C16H12BrClN2O2S — CID 54783487
5-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-2-ethoxybenzamide (PubChem CID 54783487) has the molecular formula C16H12BrClN2O2S and a molecular weight of 411.71 g/mol. Its IUPAC name is 5-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-2-ethoxybenzamide.
| Compound Name | 5-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 54783487 |
| Molecular Formula | C16H12BrClN2O2S |
| Molecular Weight | 411.71 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | 5-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-2-ethoxybenzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C16H12BrClN2O2S/c1-2-22-13-6-3-9(17)7-11(13)15(21)20-16-19-12-5-4-10(18)8-14(12)23-16/h3-8H,2H2,1H3,(H,19,20,21) |
| InChIKey | LFYOWPNZJWEHML-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |