C13H16BrClN2O2 — CID 54785679
2-(4-bromo-2-chlorophenoxy)-N-[(E)-pentan-2-ylideneamino]acetamide (PubChem CID 54785679) has the molecular formula C13H16BrClN2O2 and a molecular weight of 347.64 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[(E)-pentan-2-ylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[(E)-pentan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 54785679 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[(E)-pentan-2-ylideneamino]acetamide |
| SMILES | CCC/C(C)=N/NC(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H16BrClN2O2/c1-3-4-9(2)16-17-13(18)8-19-12-6-5-10(14)7-11(12)15/h5-7H,3-4,8H2,1-2H3,(H,17,18)/b16-9+ |
| InChIKey | ONTPEUVIIMWIOU-CXUHLZMHSA-N |
| XLogP | 3.77 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|