C17H14BrClN2O2 — CID 4923053
2-(4-bromo-2-chlorophenoxy)-N-(1,3-dihydroinden-2-ylideneamino)acetamide (PubChem CID 4923053) has the molecular formula C17H14BrClN2O2 and a molecular weight of 393.67 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-(1,3-dihydroinden-2-ylideneamino)acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-(1,3-dihydroinden-2-ylideneamino)acetamide |
|---|---|
| PubChem CID | 4923053 |
| Molecular Formula | C17H14BrClN2O2 |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-(1,3-dihydroinden-2-ylideneamino)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Cl)NN=C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H14BrClN2O2/c18-13-5-6-16(15(19)9-13)23-10-17(22)21-20-14-7-11-3-1-2-4-12(11)8-14/h1-6,9H,7-8,10H2,(H,21,22) |
| InChIKey | WEZWYWHEKBGPDK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|