C17H15FN2O2 — CID 9317079
N-(1,3-dihydroinden-2-ylideneamino)-2-(2-fluorophenoxy)acetamide (PubChem CID 9317079) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is N-(1,3-dihydroinden-2-ylideneamino)-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-(1,3-dihydroinden-2-ylideneamino)-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 9317079 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(1,3-dihydroinden-2-ylideneamino)-2-(2-fluorophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1F)NN=C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H15FN2O2/c18-15-7-3-4-8-16(15)22-11-17(21)20-19-14-9-12-5-1-2-6-13(12)10-14/h1-8H,9-11H2,(H,20,21) |
| InChIKey | SWSCANJXGQECIB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|