C24H28N2O2S — CID 54787416
2-(adamantane-1-carbonylamino)-5-benzyl-4-methylthiophene-3-carboxamide (PubChem CID 54787416) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-(adamantane-1-carbonylamino)-5-benzyl-4-methylthiophene-3-carboxamide.
| Compound Name | 2-(adamantane-1-carbonylamino)-5-benzyl-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 54787416 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-(adamantane-1-carbonylamino)-5-benzyl-4-methylthiophene-3-carboxamide |
| SMILES | Cc1c(Cc2ccccc2)sc(NC(=O)C23CC4CC(CC(C4)C2)C3)c1C(N)=O |
| InChI | InChI=1S/C24H28N2O2S/c1-14-19(10-15-5-3-2-4-6-15)29-22(20(14)21(25)27)26-23(28)24-11-16-7-17(12-24)9-18(8-16)13-24/h2-6,16-18H,7-13H2,1H3,(H2,25,27)(H,26,28) |
| InChIKey | FHPNIWRFBOTQSG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |