C17H28N4OS — CID 54788383
N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-cyclohexylpropanamide (PubChem CID 54788383) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 54788383 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-cyclohexylpropanamide |
| SMILES | N#CCCN1CCN(C(=S)NC(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H28N4OS/c18-9-4-10-20-11-13-21(14-12-20)17(23)19-16(22)8-7-15-5-2-1-3-6-15/h15H,1-8,10-14H2,(H,19,22,23) |
| InChIKey | FGCFEOXQMAOBDB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|