C17H16N4O4 — CID 54790474
3-[2,4-dinitro-N-(2-phenylethyl)anilino]propanenitrile (PubChem CID 54790474) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-[2,4-dinitro-N-(2-phenylethyl)anilino]propanenitrile.
| Compound Name | 3-[2,4-dinitro-N-(2-phenylethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 54790474 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[2,4-dinitro-N-(2-phenylethyl)anilino]propanenitrile |
| SMILES | N#CCCN(CCc1ccccc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N4O4/c18-10-4-11-19(12-9-14-5-2-1-3-6-14)16-8-7-15(20(22)23)13-17(16)21(24)25/h1-3,5-8,13H,4,9,11-12H2 |
| InChIKey | LBCHCZWKUWTVRY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 113.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|