C18H18BrN3O2S — CID 54792329
3-bromo-N-[[4-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 54792329) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 3-bromo-N-[[4-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[4-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54792329 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-bromo-N-[[4-methyl-3-(propanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(=O)Nc1cc(NC(=S)NC(=O)c2cccc(Br)c2)ccc1C |
| InChI | InChI=1S/C18H18BrN3O2S/c1-3-16(23)21-15-10-14(8-7-11(15)2)20-18(25)22-17(24)12-5-4-6-13(19)9-12/h4-10H,3H2,1-2H3,(H,21,23)(H2,20,22,24,25) |
| InChIKey | YOUIMKOSFYXXAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|