C18H32O9 — CID 547953
methyl 2-[2-acetyl-3,5-bis(2-methoxyethoxymethoxy)cyclopentyl]acetate (PubChem CID 547953) has the molecular formula C18H32O9 and a molecular weight of 392.45 g/mol. Its IUPAC name is methyl 2-[2-acetyl-3,5-bis(2-methoxyethoxymethoxy)cyclopentyl]acetate.
| Compound Name | methyl 2-[2-acetyl-3,5-bis(2-methoxyethoxymethoxy)cyclopentyl]acetate |
|---|---|
| PubChem CID | 547953 |
| Molecular Formula | C18H32O9 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methyl 2-[2-acetyl-3,5-bis(2-methoxyethoxymethoxy)cyclopentyl]acetate |
| SMILES | COCCOCOC1CC(OCOCCOC)C(C(C)=O)C1CC(=O)OC |
| InChI | InChI=1S/C18H32O9/c1-13(19)18-14(9-17(20)23-4)15(26-11-24-7-5-21-2)10-16(18)27-12-25-8-6-22-3/h14-16,18H,5-12H2,1-4H3 |
| InChIKey | FLRSEJKTURKZRT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|