C16H30O10 — CID 134916368
methyl 2-[(2S,3S,4R,5R)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetate (PubChem CID 134916368) has the molecular formula C16H30O10 and a molecular weight of 382.41 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4R,5R)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetate.
| Compound Name | methyl 2-[(2S,3S,4R,5R)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetate |
|---|---|
| PubChem CID | 134916368 |
| Molecular Formula | C16H30O10 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | methyl 2-[(2S,3S,4R,5R)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetate |
| SMILES | COCO[C@@H]1[C@H](OCOC)[C@H](OCOC)C(CC(=O)OC)[C@@H]1OCOC |
| InChI | InChI=1S/C16H30O10/c1-18-7-23-13-11(6-12(17)22-5)14(24-8-19-2)16(26-10-21-4)15(13)25-9-20-3/h11,13-16H,6-10H2,1-5H3/t11?,13-,14+,15-,16+ |
| InChIKey | WPGIYCYSUXBSFE-RMYWKNCMSA-N |
| XLogP | 0.14 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|