C18H21Cl2NO — CID 54797877
N-[2-(2-butan-2-ylphenoxy)ethyl]-2,3-dichloroaniline (PubChem CID 54797877) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is N-[2-(2-butan-2-ylphenoxy)ethyl]-2,3-dichloroaniline.
| Compound Name | N-[2-(2-butan-2-ylphenoxy)ethyl]-2,3-dichloroaniline |
|---|---|
| PubChem CID | 54797877 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[2-(2-butan-2-ylphenoxy)ethyl]-2,3-dichloroaniline |
| SMILES | CCC(C)c1ccccc1OCCNc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H21Cl2NO/c1-3-13(2)14-7-4-5-10-17(14)22-12-11-21-16-9-6-8-15(19)18(16)20/h4-10,13,21H,3,11-12H2,1-2H3 |
| InChIKey | MTYUONXSUGJSNI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|