C18H20Cl3NO — CID 54797761
N-[2-(2-butan-2-ylphenoxy)ethyl]-2,4,5-trichloroaniline (PubChem CID 54797761) has the molecular formula C18H20Cl3NO and a molecular weight of 372.72 g/mol. Its IUPAC name is N-[2-(2-butan-2-ylphenoxy)ethyl]-2,4,5-trichloroaniline.
| Compound Name | N-[2-(2-butan-2-ylphenoxy)ethyl]-2,4,5-trichloroaniline |
|---|---|
| PubChem CID | 54797761 |
| Molecular Formula | C18H20Cl3NO |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[2-(2-butan-2-ylphenoxy)ethyl]-2,4,5-trichloroaniline |
| SMILES | CCC(C)c1ccccc1OCCNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl3NO/c1-3-12(2)13-6-4-5-7-18(13)23-9-8-22-17-11-15(20)14(19)10-16(17)21/h4-7,10-12,22H,3,8-9H2,1-2H3 |
| InChIKey | JHQAFUQDHRNLFM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|